C21H23NO4 — CID 14767788
(2S)-2-(9H-fluoren-1-ylmethoxycarbonylamino)-4-methylpentanoic acid (PubChem CID 14767788) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-1-ylmethoxycarbonylamino)-4-methylpentanoic acid.
| Compound Name | (2S)-2-(9H-fluoren-1-ylmethoxycarbonylamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 14767788 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (2S)-2-(9H-fluoren-1-ylmethoxycarbonylamino)-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)OCc1cccc2c1Cc1ccccc1-2)C(=O)O |
| InChI | InChI=1S/C21H23NO4/c1-13(2)10-19(20(23)24)22-21(25)26-12-15-7-5-9-17-16-8-4-3-6-14(16)11-18(15)17/h3-9,13,19H,10-12H2,1-2H3,(H,22,25)(H,23,24)/t19-/m0/s1 |
| InChIKey | YRBYGQQJLQFTDV-IBGZPJMESA-N |
| XLogP | 3.98 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |