C27H36N6O10 — CID 175143885
2-aminoacetic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(9H-fluoren-1-ylmethoxycarbonylamino)butanedioic acid (PubChem CID 175143885) has the molecular formula C27H36N6O10 and a molecular weight of 604.62 g/mol. Its IUPAC name is 2-aminoacetic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(9H-fluoren-1-ylmethoxycarbonylamino)butanedioic acid.
| Compound Name | 2-aminoacetic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(9H-fluoren-1-ylmethoxycarbonylamino)butanedioic acid |
|---|---|
| PubChem CID | 175143885 |
| Molecular Formula | C27H36N6O10 |
| Molecular Weight | 604.62 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 2-aminoacetic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(9H-fluoren-1-ylmethoxycarbonylamino)butanedioic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)O.NCC(=O)O.O=C(O)CC(NC(=O)OCc1cccc2c1Cc1ccccc1-2)C(=O)O |
| InChI | InChI=1S/C19H17NO6.C6H14N4O2.C2H5NO2/c21-17(22)9-16(18(23)24)20-19(25)26-10-12-5-3-7-14-13-6-2-1-4-11(13)8-15(12)14;7-4(5(11)12)2-1-3-10-6(8)9;3-1-2(4)5/h1-7,16H,8-10H2,(H,20,25)(H,21,22)(H,23,24);4H,1-3,7H2,(H,11,12)(H4,8,9,10);1,3H2,(H,4,5) |
| InChIKey | BZOKYBQXFDTULZ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 303.97 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.62 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|