C21H25ClN2O4 — CID 175563676
2,6-diaminohexanoic acid;9H-fluoren-1-ylmethyl carbonochloridate (PubChem CID 175563676) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;9H-fluoren-1-ylmethyl carbonochloridate.
| Compound Name | 2,6-diaminohexanoic acid;9H-fluoren-1-ylmethyl carbonochloridate |
|---|---|
| PubChem CID | 175563676 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2,6-diaminohexanoic acid;9H-fluoren-1-ylmethyl carbonochloridate |
| SMILES | NCCCCC(N)C(=O)O.O=C(Cl)OCc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C15H11ClO2.C6H14N2O2/c16-15(17)18-9-11-5-3-7-13-12-6-2-1-4-10(12)8-14(11)13;7-4-2-1-3-5(8)6(9)10/h1-7H,8-9H2;5H,1-4,7-8H2,(H,9,10) |
| InChIKey | ALESICYIZZNLJJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|