C22H24N2O6 — CID 174973010
2,2-diamino-3-(9H-fluoren-1-ylmethoxycarbonyl)heptanedioic acid (PubChem CID 174973010) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is 2,2-diamino-3-(9H-fluoren-1-ylmethoxycarbonyl)heptanedioic acid.
| Compound Name | 2,2-diamino-3-(9H-fluoren-1-ylmethoxycarbonyl)heptanedioic acid |
|---|---|
| PubChem CID | 174973010 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2,2-diamino-3-(9H-fluoren-1-ylmethoxycarbonyl)heptanedioic acid |
| SMILES | NC(N)(C(=O)O)C(CCCC(=O)O)C(=O)OCc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C22H24N2O6/c23-22(24,21(28)29)18(9-4-10-19(25)26)20(27)30-12-14-6-3-8-16-15-7-2-1-5-13(15)11-17(14)16/h1-3,5-8,18H,4,9-12,23-24H2,(H,25,26)(H,28,29) |
| InChIKey | KRWZRXBHVIDTEF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|