C19H17NO5 — CID 23220870
3-[[2-(9H-fluoren-1-ylmethoxy)-2-oxoacetyl]amino]propanoic acid (PubChem CID 23220870) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 3-[[2-(9H-fluoren-1-ylmethoxy)-2-oxoacetyl]amino]propanoic acid.
| Compound Name | 3-[[2-(9H-fluoren-1-ylmethoxy)-2-oxoacetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23220870 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 3-[[2-(9H-fluoren-1-ylmethoxy)-2-oxoacetyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C(=O)OCc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C19H17NO5/c21-17(22)8-9-20-18(23)19(24)25-11-13-5-3-7-15-14-6-2-1-4-12(14)10-16(13)15/h1-7H,8-11H2,(H,20,23)(H,21,22) |
| InChIKey | WYNVSZACUZQUTQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|