About 9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate
9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate (PubChem CID 70186299) has the molecular formula C19H15NO4
and a molecular weight of 321.33 g/mol. Its IUPAC name is 9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | 9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate |
| PubChem CID | 70186299 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate |
| SMILES | O=C1CCC(=O)N1C(=O)OCc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C19H15NO4/c21-17-8-9-18(22)20(17)19(23)24-11-13-5-3-7-15-14-6-2-1-4-12(14)10-16(13)15/h1-7H,8-11H2 |
| InChIKey | NUCXYBQPKQTHRU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate?
The IUPAC name of 9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate (CID 70186299) is 9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate.
What is the SMILES notation for 9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate?
The canonical SMILES for 9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate is O=C1CCC(=O)N1C(=O)OCc1cccc2c1Cc1ccccc1-2.
What is the InChIKey of 9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate?
The InChIKey is NUCXYBQPKQTHRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO4/c21-17-8-9-18(22)20(17)19(23)24-11-13-5-3-7-15-14-6-2-1-4-12(14)10-16(13)15/h1-7H,8-11H2.
What are the key properties of 9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate?
9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate has a molecular weight of 321.33 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-1-ylmethyl 2,5-dioxopyrrolidine-1-carboxylate is sourced from PubChem (CID 70186299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).