C44H46N4O4 — CID 118437586
9H-fluoren-1-ylmethyl N-[[4-oxo-4-[6-(tritylamino)hexylamino]butanoyl]amino]carbamate (PubChem CID 118437586) has the molecular formula C44H46N4O4 and a molecular weight of 694.88 g/mol. Its IUPAC name is 9H-fluoren-1-ylmethyl N-[[4-oxo-4-[6-(tritylamino)hexylamino]butanoyl]amino]carbamate.
| Compound Name | 9H-fluoren-1-ylmethyl N-[[4-oxo-4-[6-(tritylamino)hexylamino]butanoyl]amino]carbamate |
|---|---|
| PubChem CID | 118437586 |
| Molecular Formula | C44H46N4O4 |
| Molecular Weight | 694.88 g/mol |
| Exact Mass | 694.35 |
| IUPAC Name | 9H-fluoren-1-ylmethyl N-[[4-oxo-4-[6-(tritylamino)hexylamino]butanoyl]amino]carbamate |
| SMILES | O=C(CCC(=O)NNC(=O)OCc1cccc2c1Cc1ccccc1-2)NCCCCCCNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H46N4O4/c49-41(27-28-42(50)47-48-43(51)52-32-34-18-16-26-39-38-25-13-12-17-33(38)31-40(34)39)45-29-14-1-2-15-30-46-44(35-19-6-3-7-20-35,36-21-8-4-9-22-36)37-23-10-5-11-24-37/h3-13,16-26,46H,1-2,14-15,27-32H2,(H,45,49)(H,47,50)(H,48,51) |
| InChIKey | VBSPFRDESDASPX-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.88 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|