C28H28N2O6 — CID 165175181
(2R)-5-(9H-fluoren-1-ylmethoxycarbonylamino)-2-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 165175181) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is (2R)-5-(9H-fluoren-1-ylmethoxycarbonylamino)-2-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | (2R)-5-(9H-fluoren-1-ylmethoxycarbonylamino)-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 165175181 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | (2R)-5-(9H-fluoren-1-ylmethoxycarbonylamino)-2-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | O=C(NCCC[C@@H](NC(=O)OCc1ccccc1)C(=O)O)OCc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C28H28N2O6/c31-26(32)25(30-28(34)35-17-19-8-2-1-3-9-19)14-7-15-29-27(33)36-18-21-11-6-13-23-22-12-5-4-10-20(22)16-24(21)23/h1-6,8-13,25H,7,14-18H2,(H,29,33)(H,30,34)(H,31,32)/t25-/m1/s1 |
| InChIKey | DTSVXENIGCLURM-RUZDIDTESA-N |
| XLogP | 4.64 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|