C21H23NO4 — CID 139831866
(2S,3S)-2-amino-2-(9H-fluoren-1-ylmethoxycarbonyl)-3-methylpentanoic acid (PubChem CID 139831866) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (2S,3S)-2-amino-2-(9H-fluoren-1-ylmethoxycarbonyl)-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-amino-2-(9H-fluoren-1-ylmethoxycarbonyl)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 139831866 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (2S,3S)-2-amino-2-(9H-fluoren-1-ylmethoxycarbonyl)-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@](N)(C(=O)O)C(=O)OCc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C21H23NO4/c1-3-13(2)21(22,19(23)24)20(25)26-12-15-8-6-10-17-16-9-5-4-7-14(16)11-18(15)17/h4-10,13H,3,11-12,22H2,1-2H3,(H,23,24)/t13-,21-/m0/s1 |
| InChIKey | TVJVVKWHPJJWMG-ZSEKCTLFSA-N |
| XLogP | 3.13 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|