C25H18F5NO5 — CID 87881323
(2,3,4,5,6-pentafluorophenyl) (2S,3R)-2-(9H-fluoren-1-ylmethoxycarbonylamino)-3-hydroxybutanoate (PubChem CID 87881323) has the molecular formula C25H18F5NO5 and a molecular weight of 507.41 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2S,3R)-2-(9H-fluoren-1-ylmethoxycarbonylamino)-3-hydroxybutanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2S,3R)-2-(9H-fluoren-1-ylmethoxycarbonylamino)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 87881323 |
| Molecular Formula | C25H18F5NO5 |
| Molecular Weight | 507.41 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2S,3R)-2-(9H-fluoren-1-ylmethoxycarbonylamino)-3-hydroxybutanoate |
| SMILES | C[C@@H](O)[C@H](NC(=O)OCc1cccc2c1Cc1ccccc1-2)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H18F5NO5/c1-11(32)22(24(33)36-23-20(29)18(27)17(26)19(28)21(23)30)31-25(34)35-10-13-6-4-8-15-14-7-3-2-5-12(14)9-16(13)15/h2-8,11,22,32H,9-10H2,1H3,(H,31,34)/t11-,22+/m1/s1 |
| InChIKey | OGKDPOOEURDDHC-XFNZEKPQSA-N |
| XLogP | 4.53 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|