C24H26N2O6 — CID 174959823
5-amino-2-[9H-fluoren-1-ylmethoxycarbonyl(prop-2-enoxycarbonyl)amino]pentanoic acid (PubChem CID 174959823) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is 5-amino-2-[9H-fluoren-1-ylmethoxycarbonyl(prop-2-enoxycarbonyl)amino]pentanoic acid.
| Compound Name | 5-amino-2-[9H-fluoren-1-ylmethoxycarbonyl(prop-2-enoxycarbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 174959823 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 5-amino-2-[9H-fluoren-1-ylmethoxycarbonyl(prop-2-enoxycarbonyl)amino]pentanoic acid |
| SMILES | C=CCOC(=O)N(C(=O)OCc1cccc2c1Cc1ccccc1-2)C(CCCN)C(=O)O |
| InChI | InChI=1S/C24H26N2O6/c1-2-13-31-23(29)26(21(22(27)28)11-6-12-25)24(30)32-15-17-8-5-10-19-18-9-4-3-7-16(18)14-20(17)19/h2-5,7-10,21H,1,6,11-15,25H2,(H,27,28) |
| InChIKey | HTXMXCQIDWOTQD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|