C28H30N2O6 — CID 70036649
3-[2-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethylamino]-2-(9H-fluoren-1-ylmethoxycarbonylamino)propanoic acid (PubChem CID 70036649) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is 3-[2-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethylamino]-2-(9H-fluoren-1-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[2-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethylamino]-2-(9H-fluoren-1-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 70036649 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 3-[2-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethylamino]-2-(9H-fluoren-1-ylmethoxycarbonylamino)propanoic acid |
| SMILES | CC1(C)CC(=O)C(=CCNCC(NC(=O)OCc2cccc3c2Cc2ccccc2-3)C(=O)O)C(=O)C1 |
| InChI | InChI=1S/C28H30N2O6/c1-28(2)13-24(31)21(25(32)14-28)10-11-29-15-23(26(33)34)30-27(35)36-16-18-7-5-9-20-19-8-4-3-6-17(19)12-22(18)20/h3-10,23,29H,11-16H2,1-2H3,(H,30,35)(H,33,34) |
| InChIKey | NWFDXJYZHKYASV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|