C31H36N2O6 — CID 15605795
(2S)-5-[3-(4,4-dimethyl-2,6-dioxocyclohexylidene)propylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (PubChem CID 15605795) has the molecular formula C31H36N2O6 and a molecular weight of 532.64 g/mol. Its IUPAC name is (2S)-5-[3-(4,4-dimethyl-2,6-dioxocyclohexylidene)propylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid.
| Compound Name | (2S)-5-[3-(4,4-dimethyl-2,6-dioxocyclohexylidene)propylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 15605795 |
| Molecular Formula | C31H36N2O6 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | (2S)-5-[3-(4,4-dimethyl-2,6-dioxocyclohexylidene)propylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| SMILES | CC1(C)CC(=O)C(=CCCNCCC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)C(=O)C1 |
| InChI | InChI=1S/C31H36N2O6/c1-31(2)17-27(34)24(28(35)18-31)13-7-15-32-16-8-14-26(29(36)37)33-30(38)39-19-25-22-11-5-3-9-20(22)21-10-4-6-12-23(21)25/h3-6,9-13,25-26,32H,7-8,14-19H2,1-2H3,(H,33,38)(H,36,37)/t26-/m0/s1 |
| InChIKey | PUJPHQZMCIRFON-SANMLTNESA-N |
| XLogP | 4.62 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|