C13H21NOS — CID 43792913
4-[ethyl(propan-2-yl)amino]-1-thiophen-2-ylbutan-1-one (PubChem CID 43792913) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is 4-[ethyl(propan-2-yl)amino]-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-[ethyl(propan-2-yl)amino]-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 43792913 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 4-[ethyl(propan-2-yl)amino]-1-thiophen-2-ylbutan-1-one |
| SMILES | CCN(CCCC(=O)c1cccs1)C(C)C |
| InChI | InChI=1S/C13H21NOS/c1-4-14(11(2)3)9-5-7-12(15)13-8-6-10-16-13/h6,8,10-11H,4-5,7,9H2,1-3H3 |
| InChIKey | OANREJJKKJYFDU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |