C12H21NS — CID 67813674
N-ethyl-N-propan-2-yl-3-thiophen-2-ylpropan-1-amine (PubChem CID 67813674) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is N-ethyl-N-propan-2-yl-3-thiophen-2-ylpropan-1-amine.
| Compound Name | N-ethyl-N-propan-2-yl-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 67813674 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | N-ethyl-N-propan-2-yl-3-thiophen-2-ylpropan-1-amine |
| SMILES | CCN(CCCc1cccs1)C(C)C |
| InChI | InChI=1S/C12H21NS/c1-4-13(11(2)3)9-5-7-12-8-6-10-14-12/h6,8,10-11H,4-5,7,9H2,1-3H3 |
| InChIKey | PCPJYCMQLSSGNE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |