2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride

C9H10ClN3O2 — CID 44669927

IUPAC2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride
SMILESO=[N+]([O-])c1cccc(C2=[NH+]CCN2)c1.[Cl-]
InChIInChI=1S/C9H9N3O2.ClH/c13-12(14)8-3-1-2-7(6-8)9-10-4-5-11-9;/h1-3,6H,4-5H2,(H,10,11);1H
InChIKeyRNBMIYCXUOTSQT-UHFFFAOYSA-N
MW227.65 g/mol
LogP-3.97
Rot. Bonds2

About 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride

2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride (PubChem CID 44669927) has the molecular formula C9H10ClN3O2 and a molecular weight of 227.65 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride.

Molecular Properties

Compound Name2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride
PubChem CID44669927
Molecular FormulaC9H10ClN3O2
Molecular Weight227.65 g/mol
Exact Mass227.05
IUPAC Name2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride
SMILESO=[N+]([O-])c1cccc(C2=[NH+]CCN2)c1.[Cl-]
InChIInChI=1S/C9H9N3O2.ClH/c13-12(14)8-3-1-2-7(6-8)9-10-4-5-11-9;/h1-3,6H,4-5H2,(H,10,11);1H
InChIKeyRNBMIYCXUOTSQT-UHFFFAOYSA-N
XLogP-3.97
TPSA69.14 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.65
LogP ≤ 5-3.97
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride?
The IUPAC name of 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride (CID 44669927) is 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride.
What is the SMILES notation for 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride?
The canonical SMILES for 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride is O=[N+]([O-])c1cccc(C2=[NH+]CCN2)c1.[Cl-].
What is the InChIKey of 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride?
The InChIKey is RNBMIYCXUOTSQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2.ClH/c13-12(14)8-3-1-2-7(6-8)9-10-4-5-11-9;/h1-3,6H,4-5H2,(H,10,11);1H.
What are the key properties of 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride?
2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride has a molecular weight of 227.65 g/mol, XLogP of -3.97, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride is sourced from PubChem (CID 44669927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).