C9H10ClN3O2 — CID 44669927
2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride (PubChem CID 44669927) has the molecular formula C9H10ClN3O2 and a molecular weight of 227.65 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride.
| Compound Name | 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride |
|---|---|
| PubChem CID | 44669927 |
| Molecular Formula | C9H10ClN3O2 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazol-3-ium chloride |
| SMILES | O=[N+]([O-])c1cccc(C2=[NH+]CCN2)c1.[Cl-] |
| InChI | InChI=1S/C9H9N3O2.ClH/c13-12(14)8-3-1-2-7(6-8)9-10-4-5-11-9;/h1-3,6H,4-5H2,(H,10,11);1H |
| InChIKey | RNBMIYCXUOTSQT-UHFFFAOYSA-N |
| XLogP | -3.97 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | -3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|