C19H23N — CID 63489421
3-(2-methylpropyl)-7-phenyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 63489421) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 3-(2-methylpropyl)-7-phenyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 3-(2-methylpropyl)-7-phenyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 63489421 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 3-(2-methylpropyl)-7-phenyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC(C)CC1Cc2ccc(-c3ccccc3)cc2CN1 |
| InChI | InChI=1S/C19H23N/c1-14(2)10-19-12-17-9-8-16(11-18(17)13-20-19)15-6-4-3-5-7-15/h3-9,11,14,19-20H,10,12-13H2,1-2H3 |
| InChIKey | BVPLBJACYWTSBH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |