C13H13N2+ — CID 131979260
5-pyridin-1-ium-1-yl-2,3-dihydro-1H-isoindole (PubChem CID 131979260) has the molecular formula C13H13N2+ and a molecular weight of 197.26 g/mol. Its IUPAC name is 5-pyridin-1-ium-1-yl-2,3-dihydro-1H-isoindole.
| Compound Name | 5-pyridin-1-ium-1-yl-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 131979260 |
| Molecular Formula | C13H13N2+ |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 5-pyridin-1-ium-1-yl-2,3-dihydro-1H-isoindole |
| SMILES | c1cc[n+](-c2ccc3c(c2)CNC3)cc1 |
| InChI | InChI=1S/C13H13N2/c1-2-6-15(7-3-1)13-5-4-11-9-14-10-12(11)8-13/h1-8,14H,9-10H2/q+1 |
| InChIKey | FMIMFQXJMWPGLR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|