C16H28N4 — CID 122553501
but-1-ene;2,5,8,11-tetrazabicyclo[10.4.0]hexadeca-1(16),12,14-triene (PubChem CID 122553501) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is but-1-ene;2,5,8,11-tetrazabicyclo[10.4.0]hexadeca-1(16),12,14-triene.
| Compound Name | but-1-ene;2,5,8,11-tetrazabicyclo[10.4.0]hexadeca-1(16),12,14-triene |
|---|---|
| PubChem CID | 122553501 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | but-1-ene;2,5,8,11-tetrazabicyclo[10.4.0]hexadeca-1(16),12,14-triene |
| SMILES | C=CCC.c1ccc2c(c1)NCCNCCNCCN2 |
| InChI | InChI=1S/C12H20N4.C4H8/c1-2-4-12-11(3-1)15-9-7-13-5-6-14-8-10-16-12;1-3-4-2/h1-4,13-16H,5-10H2;3H,1,4H2,2H3 |
| InChIKey | SYJXLWDLQUKUPB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|