C17H26N4O3 — CID 142077513
ethyl 3-[5-(1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-6-yl)pentanoylamino]propanoate (PubChem CID 142077513) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is ethyl 3-[5-(1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-6-yl)pentanoylamino]propanoate.
| Compound Name | ethyl 3-[5-(1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-6-yl)pentanoylamino]propanoate |
|---|---|
| PubChem CID | 142077513 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | ethyl 3-[5-(1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-6-yl)pentanoylamino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)CCCCc1ccc2c(n1)NCCN2 |
| InChI | InChI=1S/C17H26N4O3/c1-2-24-16(23)9-10-19-15(22)6-4-3-5-13-7-8-14-17(21-13)20-12-11-18-14/h7-8,18H,2-6,9-12H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | FBMHBJFRSKCLBE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|