C33H46N4O4S — CID 166471639
methyl 3-methyl-2-[2-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]ethyl]butanoate;1-(6-propyl-1,3-benzothiazol-2-yl)ethanone (PubChem CID 166471639) has the molecular formula C33H46N4O4S and a molecular weight of 594.82 g/mol. Its IUPAC name is methyl 3-methyl-2-[2-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]ethyl]butanoate;1-(6-propyl-1,3-benzothiazol-2-yl)ethanone.
| Compound Name | methyl 3-methyl-2-[2-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]ethyl]butanoate;1-(6-propyl-1,3-benzothiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 166471639 |
| Molecular Formula | C33H46N4O4S |
| Molecular Weight | 594.82 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | methyl 3-methyl-2-[2-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]ethyl]butanoate;1-(6-propyl-1,3-benzothiazol-2-yl)ethanone |
| SMILES | CCCc1ccc2nc(C(C)=O)sc2c1.COC(=O)C(CCNC(=O)CCCCc1ccc2c(n1)NCCC2)C(C)C |
| InChI | InChI=1S/C21H33N3O3.C12H13NOS/c1-15(2)18(21(26)27-3)12-14-22-19(25)9-5-4-8-17-11-10-16-7-6-13-23-20(16)24-17;1-3-4-9-5-6-10-11(7-9)15-12(13-10)8(2)14/h10-11,15,18H,4-9,12-14H2,1-3H3,(H,22,25)(H,23,24);5-7H,3-4H2,1-2H3 |
| InChIKey | STVUUWNEQYGNNI-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.82 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|