C28H35N3O2S — CID 22678210
tert-butyl (Z)-3-(1,3-benzothiazol-2-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-2-enoate (PubChem CID 22678210) has the molecular formula C28H35N3O2S and a molecular weight of 477.67 g/mol. Its IUPAC name is tert-butyl (Z)-3-(1,3-benzothiazol-2-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-2-enoate.
| Compound Name | tert-butyl (Z)-3-(1,3-benzothiazol-2-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-2-enoate |
|---|---|
| PubChem CID | 22678210 |
| Molecular Formula | C28H35N3O2S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | tert-butyl (Z)-3-(1,3-benzothiazol-2-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C(/CCCCCCc1ccc2c(n1)NCCC2)c1nc2ccccc2s1 |
| InChI | InChI=1S/C28H35N3O2S/c1-28(2,3)33-25(32)19-21(27-31-23-14-8-9-15-24(23)34-27)11-6-4-5-7-13-22-17-16-20-12-10-18-29-26(20)30-22/h8-9,14-17,19H,4-7,10-13,18H2,1-3H3,(H,29,30)/b21-19- |
| InChIKey | DFHISZKXZDMCKV-VZCXRCSSSA-N |
| XLogP | 6.97 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|