C25H28N2O2S — CID 154222557
3-(1-benzothiophen-2-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-2-enoic acid (PubChem CID 154222557) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is 3-(1-benzothiophen-2-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-2-enoic acid.
| Compound Name | 3-(1-benzothiophen-2-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-2-enoic acid |
|---|---|
| PubChem CID | 154222557 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 3-(1-benzothiophen-2-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-2-enoic acid |
| SMILES | O=C(O)C=C(CCCCCCc1ccc2c(n1)NCCC2)c1cc2ccccc2s1 |
| InChI | InChI=1S/C25H28N2O2S/c28-24(29)17-20(23-16-19-9-5-6-12-22(19)30-23)8-3-1-2-4-11-21-14-13-18-10-7-15-26-25(18)27-21/h5-6,9,12-14,16-17H,1-4,7-8,10-11,15H2,(H,26,27)(H,28,29) |
| InChIKey | OWWXGLPWVYZQJQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|