C32H48N6O4 — CID 160963957
tert-butyl N-[3-(1,8-naphthyridin-2-yl)propyl]carbamate;tert-butyl N-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]carbamate;molecular hydrogen (PubChem CID 160963957) has the molecular formula C32H48N6O4 and a molecular weight of 580.77 g/mol. Its IUPAC name is tert-butyl N-[3-(1,8-naphthyridin-2-yl)propyl]carbamate;tert-butyl N-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]carbamate;molecular hydrogen.
| Compound Name | tert-butyl N-[3-(1,8-naphthyridin-2-yl)propyl]carbamate;tert-butyl N-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 160963957 |
| Molecular Formula | C32H48N6O4 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.37 |
| IUPAC Name | tert-butyl N-[3-(1,8-naphthyridin-2-yl)propyl]carbamate;tert-butyl N-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]carbamate;molecular hydrogen |
| SMILES | CC(C)(C)OC(=O)NCCCc1ccc2c(n1)NCCC2.CC(C)(C)OC(=O)NCCCc1ccc2cccnc2n1.[H][H] |
| InChI | InChI=1S/C16H25N3O2.C16H21N3O2.H2/c2*1-16(2,3)21-15(20)18-11-5-7-13-9-8-12-6-4-10-17-14(12)19-13;/h8-9H,4-7,10-11H2,1-3H3,(H,17,19)(H,18,20);4,6,8-10H,5,7,11H2,1-3H3,(H,18,20);1H |
| InChIKey | SXJHXGBVQOKECP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|