C27H48N6O3 — CID 153342618
tert-butyl (2S)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(ethenylamino)methylideneamino]butanoate;molecular hydrogen (PubChem CID 153342618) has the molecular formula C27H48N6O3 and a molecular weight of 504.72 g/mol. Its IUPAC name is tert-butyl (2S)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(ethenylamino)methylideneamino]butanoate;molecular hydrogen.
| Compound Name | tert-butyl (2S)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(ethenylamino)methylideneamino]butanoate;molecular hydrogen |
|---|---|
| PubChem CID | 153342618 |
| Molecular Formula | C27H48N6O3 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.38 |
| IUPAC Name | tert-butyl (2S)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(ethenylamino)methylideneamino]butanoate;molecular hydrogen |
| SMILES | C=CN/C=N/[C@@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCNC(C)=O)C(=O)OC(C)(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C27H44N6O3.2H2/c1-6-28-20-31-24(26(35)36-27(3,4)5)14-18-33(19-16-29-21(2)34)17-8-7-11-23-13-12-22-10-9-15-30-25(22)32-23;;/h6,12-13,20,24H,1,7-11,14-19H2,2-5H3,(H,28,31)(H,29,34)(H,30,32);2*1H/t24-;;/m0../s1 |
| InChIKey | TYECOOYRTNACDL-ASMAMLKCSA-N |
| XLogP | 3.55 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|