C22H35N3O6 — CID 151671564
methyl (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyloxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoate (PubChem CID 151671564) has the molecular formula C22H35N3O6 and a molecular weight of 437.54 g/mol. Its IUPAC name is methyl (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyloxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoate.
| Compound Name | methyl (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyloxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoate |
|---|---|
| PubChem CID | 151671564 |
| Molecular Formula | C22H35N3O6 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | methyl (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyloxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoate |
| SMILES | COC(=O)[C@H](CCO)N(CCCCc1ccc2c(n1)NCCC2)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35N3O6/c1-22(2,3)30-21(28)31-25(18(12-15-26)20(27)29-4)14-6-5-9-17-11-10-16-8-7-13-23-19(16)24-17/h10-11,18,26H,5-9,12-15H2,1-4H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | QYQXQTPKEBMUOK-SFHVURJKSA-N |
| XLogP | 2.86 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|