C22H35N3O5 — CID 150712245
(2S)-2-[2-ethylbutanoyloxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-4-hydroxybutanoic acid (PubChem CID 150712245) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is (2S)-2-[2-ethylbutanoyloxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[2-ethylbutanoyloxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 150712245 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | (2S)-2-[2-ethylbutanoyloxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-4-hydroxybutanoic acid |
| SMILES | CCC(CC)C(=O)ON(CCCCc1ccc2c(n1)NCCC2)[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C22H35N3O5/c1-3-16(4-2)22(29)30-25(19(12-15-26)21(27)28)14-6-5-9-18-11-10-17-8-7-13-23-20(17)24-18/h10-11,16,19,26H,3-9,12-15H2,1-2H3,(H,23,24)(H,27,28)/t19-/m0/s1 |
| InChIKey | JODDURWFYUYUGT-IBGZPJMESA-N |
| XLogP | 2.79 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|