C28H36FN3O5 — CID 172718109
(2S)-2-[[2-(4-fluorophenyl)-2-methylpropanoyl]oxy-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]amino]-4-hydroxybutanoic acid (PubChem CID 172718109) has the molecular formula C28H36FN3O5 and a molecular weight of 513.61 g/mol. Its IUPAC name is (2S)-2-[[2-(4-fluorophenyl)-2-methylpropanoyl]oxy-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[[2-(4-fluorophenyl)-2-methylpropanoyl]oxy-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 172718109 |
| Molecular Formula | C28H36FN3O5 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | (2S)-2-[[2-(4-fluorophenyl)-2-methylpropanoyl]oxy-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]amino]-4-hydroxybutanoic acid |
| SMILES | CC(C)(C(=O)ON(C1CC(CCc2ccc3c(n2)NCCC3)C1)[C@@H](CCO)C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H36FN3O5/c1-28(2,20-7-9-21(29)10-8-20)27(36)37-32(24(13-15-33)26(34)35)23-16-18(17-23)5-11-22-12-6-19-4-3-14-30-25(19)31-22/h6-10,12,18,23-24,33H,3-5,11,13-17H2,1-2H3,(H,30,31)(H,34,35)/t18?,23?,24-/m0/s1 |
| InChIKey | GDFKDOSBEGSKIM-WQMGSUCASA-N |
| XLogP | 3.86 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|