C24H37N3O5 — CID 146462730
(2S,3R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid (PubChem CID 146462730) has the molecular formula C24H37N3O5 and a molecular weight of 447.58 g/mol. Its IUPAC name is (2S,3R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid.
| Compound Name | (2S,3R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
|---|---|
| PubChem CID | 146462730 |
| Molecular Formula | C24H37N3O5 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | (2S,3R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
| SMILES | C[C@@H](COC1CC(CCc2ccc3c(n2)NCCC3)C1)[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C24H37N3O5/c1-15(20(22(28)29)27-23(30)32-24(2,3)4)14-31-19-12-16(13-19)7-9-18-10-8-17-6-5-11-25-21(17)26-18/h8,10,15-16,19-20H,5-7,9,11-14H2,1-4H3,(H,25,26)(H,27,30)(H,28,29)/t15-,16?,19?,20-/m0/s1 |
| InChIKey | CLZXTIJSAYKCAB-MUAOVLSHSA-N |
| XLogP | 3.78 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |