C25H29F2N3O5 — CID 172782197
(2S)-2-[(2,4-difluorobenzoyl)oxy-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]amino]-4-hydroxybutanoic acid (PubChem CID 172782197) has the molecular formula C25H29F2N3O5 and a molecular weight of 489.52 g/mol. Its IUPAC name is (2S)-2-[(2,4-difluorobenzoyl)oxy-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[(2,4-difluorobenzoyl)oxy-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 172782197 |
| Molecular Formula | C25H29F2N3O5 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | (2S)-2-[(2,4-difluorobenzoyl)oxy-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]amino]-4-hydroxybutanoic acid |
| SMILES | O=C(ON(C1CC(CCc2ccc3c(n2)NCCC3)C1)[C@@H](CCO)C(=O)O)c1ccc(F)cc1F |
| InChI | InChI=1S/C25H29F2N3O5/c26-17-5-8-20(21(27)14-17)25(34)35-30(22(9-11-31)24(32)33)19-12-15(13-19)3-6-18-7-4-16-2-1-10-28-23(16)29-18/h4-5,7-8,14-15,19,22,31H,1-3,6,9-13H2,(H,28,29)(H,32,33)/t15?,19?,22-/m0/s1 |
| InChIKey | OKGGCXCXXCKNPN-PNMBIXSGSA-N |
| XLogP | 3.34 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|