C25H29FN4O5 — CID 172844502
(2S)-2-[(4-cyano-2-fluoro-6-methylbenzoyl)oxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-4-hydroxybutanoic acid (PubChem CID 172844502) has the molecular formula C25H29FN4O5 and a molecular weight of 484.53 g/mol. Its IUPAC name is (2S)-2-[(4-cyano-2-fluoro-6-methylbenzoyl)oxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[(4-cyano-2-fluoro-6-methylbenzoyl)oxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 172844502 |
| Molecular Formula | C25H29FN4O5 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | (2S)-2-[(4-cyano-2-fluoro-6-methylbenzoyl)oxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-4-hydroxybutanoic acid |
| SMILES | Cc1cc(C#N)cc(F)c1C(=O)ON(CCCCc1ccc2c(n1)NCCC2)[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C25H29FN4O5/c1-16-13-17(15-27)14-20(26)22(16)25(34)35-30(21(9-12-31)24(32)33)11-3-2-6-19-8-7-18-5-4-10-28-23(18)29-19/h7-8,13-14,21,31H,2-6,9-12H2,1H3,(H,28,29)(H,32,33)/t21-/m0/s1 |
| InChIKey | XFUWIQONXCDCLE-NRFANRHFSA-N |
| XLogP | 2.99 |
| TPSA | 135.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|