C23H35N3O6 — CID 150325003
(2S)-4-hydroxy-2-[(4-methyloxane-4-carbonyl)oxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 150325003) has the molecular formula C23H35N3O6 and a molecular weight of 449.55 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-[(4-methyloxane-4-carbonyl)oxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-[(4-methyloxane-4-carbonyl)oxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 150325003 |
| Molecular Formula | C23H35N3O6 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | (2S)-4-hydroxy-2-[(4-methyloxane-4-carbonyl)oxy-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | CC1(C(=O)ON(CCCCc2ccc3c(n2)NCCC3)[C@@H](CCO)C(=O)O)CCOCC1 |
| InChI | InChI=1S/C23H35N3O6/c1-23(10-15-31-16-11-23)22(30)32-26(19(9-14-27)21(28)29)13-3-2-6-18-8-7-17-5-4-12-24-20(17)25-18/h7-8,19,27H,2-6,9-16H2,1H3,(H,24,25)(H,28,29)/t19-/m0/s1 |
| InChIKey | GOLAJECFTUJIDR-IBGZPJMESA-N |
| XLogP | 2.17 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|