About 5-chloro-4-fluoro-2,3-dihydro-1H-indole;hydrochloride
5-chloro-4-fluoro-2,3-dihydro-1H-indole;hydrochloride (PubChem CID 135392566) has the molecular formula C8H8Cl2FN
and a molecular weight of 208.06 g/mol. Its IUPAC name is 5-chloro-4-fluoro-2,3-dihydro-1H-indole;hydrochloride.
Analyze 5-chloro-4-fluoro-2,3-dihydro-1H-indole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-fluoro-2,3-dihydro-1H-indole;hydrochloride?
The IUPAC name of 5-chloro-4-fluoro-2,3-dihydro-1H-indole;hydrochloride (CID 135392566) is 5-chloro-4-fluoro-2,3-dihydro-1H-indole;hydrochloride.
What is the SMILES notation for 5-chloro-4-fluoro-2,3-dihydro-1H-indole;hydrochloride?
The canonical SMILES for 5-chloro-4-fluoro-2,3-dihydro-1H-indole;hydrochloride is Cl.Fc1c(Cl)ccc2c1CCN2.
What is the InChIKey of 5-chloro-4-fluoro-2,3-dihydro-1H-indole;hydrochloride?
The InChIKey is ZOOBELAFLMMWGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClFN.ClH/c9-6-1-2-7-5(8(6)10)3-4-11-7;/h1-2,11H,3-4H2;1H.
What are the key properties of 5-chloro-4-fluoro-2,3-dihydro-1H-indole;hydrochloride?
5-chloro-4-fluoro-2,3-dihydro-1H-indole;hydrochloride has a molecular weight of 208.06 g/mol, XLogP of 2.87, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-fluoro-2,3-dihydro-1H-indole;hydrochloride is sourced from PubChem (CID 135392566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).