C10H11Br2N — CID 126978984
5,8-dibromo-4-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 126978984) has the molecular formula C10H11Br2N and a molecular weight of 305.01 g/mol. Its IUPAC name is 5,8-dibromo-4-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5,8-dibromo-4-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 126978984 |
| Molecular Formula | C10H11Br2N |
| Molecular Weight | 305.01 g/mol |
| Exact Mass | 302.93 |
| IUPAC Name | 5,8-dibromo-4-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1CCNc2c(Br)ccc(Br)c21 |
| InChI | InChI=1S/C10H11Br2N/c1-6-4-5-13-10-8(12)3-2-7(11)9(6)10/h2-3,6,13H,4-5H2,1H3 |
| InChIKey | PJVJLGAUTJQCCS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.01 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |