C16H14FIN4 — CID 170364630
6-(5-fluoro-6-iodo-1H-indazol-3-yl)-4-methyl-1,2,3,4-tetrahydro-1,5-naphthyridine (PubChem CID 170364630) has the molecular formula C16H14FIN4 and a molecular weight of 408.22 g/mol. Its IUPAC name is 6-(5-fluoro-6-iodo-1H-indazol-3-yl)-4-methyl-1,2,3,4-tetrahydro-1,5-naphthyridine.
| Compound Name | 6-(5-fluoro-6-iodo-1H-indazol-3-yl)-4-methyl-1,2,3,4-tetrahydro-1,5-naphthyridine |
|---|---|
| PubChem CID | 170364630 |
| Molecular Formula | C16H14FIN4 |
| Molecular Weight | 408.22 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 6-(5-fluoro-6-iodo-1H-indazol-3-yl)-4-methyl-1,2,3,4-tetrahydro-1,5-naphthyridine |
| SMILES | CC1CCNc2ccc(-c3n[nH]c4cc(I)c(F)cc34)nc21 |
| InChI | InChI=1S/C16H14FIN4/c1-8-4-5-19-12-2-3-13(20-15(8)12)16-9-6-10(17)11(18)7-14(9)21-22-16/h2-3,6-8,19H,4-5H2,1H3,(H,21,22) |
| InChIKey | JGVPOECGVKPAJO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|