C11H16N2 — CID 112714469
6,6-dimethyl-7,8-dihydro-5H-isoquinolin-5-amine (PubChem CID 112714469) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 6,6-dimethyl-7,8-dihydro-5H-isoquinolin-5-amine.
| Compound Name | 6,6-dimethyl-7,8-dihydro-5H-isoquinolin-5-amine |
|---|---|
| PubChem CID | 112714469 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 6,6-dimethyl-7,8-dihydro-5H-isoquinolin-5-amine |
| SMILES | CC1(C)CCc2cnccc2C1N |
| InChI | InChI=1S/C11H16N2/c1-11(2)5-3-8-7-13-6-4-9(8)10(11)12/h4,6-7,10H,3,5,12H2,1-2H3 |
| InChIKey | BPGROVBOXRSSOK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |