C9H14N2O — CID 112714362
5,5-dimethyl-6,7-dihydro-4H-1,2-benzoxazol-4-amine (PubChem CID 112714362) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 5,5-dimethyl-6,7-dihydro-4H-1,2-benzoxazol-4-amine.
| Compound Name | 5,5-dimethyl-6,7-dihydro-4H-1,2-benzoxazol-4-amine |
|---|---|
| PubChem CID | 112714362 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 5,5-dimethyl-6,7-dihydro-4H-1,2-benzoxazol-4-amine |
| SMILES | CC1(C)CCc2oncc2C1N |
| InChI | InChI=1S/C9H14N2O/c1-9(2)4-3-7-6(8(9)10)5-11-12-7/h5,8H,3-4,10H2,1-2H3 |
| InChIKey | KRJDGCIIEGZLFV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |