C7H10N2O — CID 92546013
(6S)-4,5,6,7-tetrahydro-1,2-benzoxazol-6-amine (PubChem CID 92546013) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is (6S)-4,5,6,7-tetrahydro-1,2-benzoxazol-6-amine.
| Compound Name | (6S)-4,5,6,7-tetrahydro-1,2-benzoxazol-6-amine |
|---|---|
| PubChem CID | 92546013 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (6S)-4,5,6,7-tetrahydro-1,2-benzoxazol-6-amine |
| SMILES | N[C@H]1CCc2cnoc2C1 |
| InChI | InChI=1S/C7H10N2O/c8-6-2-1-5-4-9-10-7(5)3-6/h4,6H,1-3,8H2/t6-/m0/s1 |
| InChIKey | OHRAOQCRJOFNHL-LURJTMIESA-N |
| XLogP | 0.49 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |