About 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-6-amine
5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-6-amine (PubChem CID 82418900) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-6-amine.
Analyze 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-6-amine?
The IUPAC name of 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-6-amine (CID 82418900) is 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-6-amine.
What is the SMILES notation for 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-6-amine?
The canonical SMILES for 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-6-amine is NC1CCc2cnoc21.
What is the InChIKey of 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-6-amine?
The InChIKey is MGIXGJLZGBVXJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O/c7-5-2-1-4-3-8-9-6(4)5/h3,5H,1-2,7H2.
What are the key properties of 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-6-amine?
5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-6-amine has a molecular weight of 124.14 g/mol, XLogP of 0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-6-amine is sourced from PubChem (CID 82418900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).