About 6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride
6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride (PubChem CID 138393726) has the molecular formula C8H12Cl2N2
and a molecular weight of 207.10 g/mol. Its IUPAC name is 6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride |
| PubChem CID | 138393726 |
| Molecular Formula | C8H12Cl2N2 |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CCc2ccncc21 |
| InChI | InChI=1S/C8H10N2.2ClH/c9-8-2-1-6-3-4-10-5-7(6)8;;/h3-5,8H,1-2,9H2;2*1H |
| InChIKey | OYOUUGAMAJSUGQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride?
The IUPAC name of 6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride (CID 138393726) is 6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride.
What is the SMILES notation for 6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride?
The canonical SMILES for 6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride is Cl.Cl.NC1CCc2ccncc21.
What is the InChIKey of 6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride?
The InChIKey is OYOUUGAMAJSUGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2.2ClH/c9-8-2-1-6-3-4-10-5-7(6)8;;/h3-5,8H,1-2,9H2;2*1H.
What are the key properties of 6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride?
6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride has a molecular weight of 207.10 g/mol, XLogP of 1.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;dihydrochloride is sourced from PubChem (CID 138393726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).