C17H27N — CID 139483291
7,8-ditert-butyl-5,6,7,8-tetrahydroisoquinoline (PubChem CID 139483291) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 7,8-ditert-butyl-5,6,7,8-tetrahydroisoquinoline.
| Compound Name | 7,8-ditert-butyl-5,6,7,8-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 139483291 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 7,8-ditert-butyl-5,6,7,8-tetrahydroisoquinoline |
| SMILES | CC(C)(C)C1CCc2ccncc2C1C(C)(C)C |
| InChI | InChI=1S/C17H27N/c1-16(2,3)14-8-7-12-9-10-18-11-13(12)15(14)17(4,5)6/h9-11,14-15H,7-8H2,1-6H3 |
| InChIKey | JEJRUFDSRCGRLO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |