C18H29NS — CID 139483688
3-(7-tert-butyl-5,6,7,8-tetrahydroisoquinolin-8-yl)-3-methylbutane-1-thiol (PubChem CID 139483688) has the molecular formula C18H29NS and a molecular weight of 291.50 g/mol. Its IUPAC name is 3-(7-tert-butyl-5,6,7,8-tetrahydroisoquinolin-8-yl)-3-methylbutane-1-thiol.
| Compound Name | 3-(7-tert-butyl-5,6,7,8-tetrahydroisoquinolin-8-yl)-3-methylbutane-1-thiol |
|---|---|
| PubChem CID | 139483688 |
| Molecular Formula | C18H29NS |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 3-(7-tert-butyl-5,6,7,8-tetrahydroisoquinolin-8-yl)-3-methylbutane-1-thiol |
| SMILES | CC(C)(C)C1CCc2ccncc2C1C(C)(C)CCS |
| InChI | InChI=1S/C18H29NS/c1-17(2,3)15-7-6-13-8-10-19-12-14(13)16(15)18(4,5)9-11-20/h8,10,12,15-16,20H,6-7,9,11H2,1-5H3 |
| InChIKey | KYJZLUNEMQENQA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|