C10H12IN — CID 139478548
7-iodo-8-methyl-5,6,7,8-tetrahydroisoquinoline (PubChem CID 139478548) has the molecular formula C10H12IN and a molecular weight of 273.12 g/mol. Its IUPAC name is 7-iodo-8-methyl-5,6,7,8-tetrahydroisoquinoline.
| Compound Name | 7-iodo-8-methyl-5,6,7,8-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 139478548 |
| Molecular Formula | C10H12IN |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 7-iodo-8-methyl-5,6,7,8-tetrahydroisoquinoline |
| SMILES | CC1c2cnccc2CCC1I |
| InChI | InChI=1S/C10H12IN/c1-7-9-6-12-5-4-8(9)2-3-10(7)11/h4-7,10H,2-3H2,1H3 |
| InChIKey | NEPCHVSKTHKILN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|