About 2-(4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl)ethanamine
2-(4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl)ethanamine (PubChem CID 83873526) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-(4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl)ethanamine.
Analyze 2-(4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl)ethanamine?
The IUPAC name of 2-(4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl)ethanamine (CID 83873526) is 2-(4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl)ethanamine.
What is the SMILES notation for 2-(4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl)ethanamine?
The canonical SMILES for 2-(4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl)ethanamine is NCCC1CCCc2cnoc21.
What is the InChIKey of 2-(4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl)ethanamine?
The InChIKey is MSPDUEBONNRVCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c10-5-4-7-2-1-3-8-6-11-12-9(7)8/h6-7H,1-5,10H2.
What are the key properties of 2-(4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl)ethanamine?
2-(4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl)ethanamine has a molecular weight of 166.22 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl)ethanamine is sourced from PubChem (CID 83873526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).