C10H16N4 — CID 83878214
8-(2-aminoethyl)-5,6,7,8-tetrahydroquinazolin-2-amine (PubChem CID 83878214) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 8-(2-aminoethyl)-5,6,7,8-tetrahydroquinazolin-2-amine.
| Compound Name | 8-(2-aminoethyl)-5,6,7,8-tetrahydroquinazolin-2-amine |
|---|---|
| PubChem CID | 83878214 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 8-(2-aminoethyl)-5,6,7,8-tetrahydroquinazolin-2-amine |
| SMILES | NCCC1CCCc2cnc(N)nc21 |
| InChI | InChI=1S/C10H16N4/c11-5-4-7-2-1-3-8-6-13-10(12)14-9(7)8/h6-7H,1-5,11H2,(H2,12,13,14) |
| InChIKey | DZAPAWXYXYUBCI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |