About 6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol
6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol (PubChem CID 139478243) has the molecular formula C9H11NS
and a molecular weight of 165.26 g/mol. Its IUPAC name is 6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol.
Molecular Properties
| Compound Name | 6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol |
| PubChem CID | 139478243 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol |
| SMILES | CC1Cc2cnccc2C1S |
| InChI | InChI=1S/C9H11NS/c1-6-4-7-5-10-3-2-8(7)9(6)11/h2-3,5-6,9,11H,4H2,1H3 |
| InChIKey | ZQCKVMIYFUNNMJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol?
The IUPAC name of 6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol (CID 139478243) is 6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol.
What is the SMILES notation for 6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol?
The canonical SMILES for 6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol is CC1Cc2cnccc2C1S.
What is the InChIKey of 6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol?
The InChIKey is ZQCKVMIYFUNNMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS/c1-6-4-7-5-10-3-2-8(7)9(6)11/h2-3,5-6,9,11H,4H2,1H3.
What are the key properties of 6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol?
6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol has a molecular weight of 165.26 g/mol, XLogP of 2.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-5-thiol is sourced from PubChem (CID 139478243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).