C13H12N2 — CID 58091555
5-methyl-5,10-dihydropyrido[4,3-g]quinoline (PubChem CID 58091555) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-methyl-5,10-dihydropyrido[4,3-g]quinoline.
| Compound Name | 5-methyl-5,10-dihydropyrido[4,3-g]quinoline |
|---|---|
| PubChem CID | 58091555 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 5-methyl-5,10-dihydropyrido[4,3-g]quinoline |
| SMILES | CC1c2ccncc2Cc2ncccc21 |
| InChI | InChI=1S/C13H12N2/c1-9-11-4-6-14-8-10(11)7-13-12(9)3-2-5-15-13/h2-6,8-9H,7H2,1H3 |
| InChIKey | YZNOFWCHVUZVRO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |