C11H16N2O — CID 142177834
ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one (PubChem CID 142177834) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one.
| Compound Name | ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one |
|---|---|
| PubChem CID | 142177834 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one |
| SMILES | CC.CC1C(=O)NCc2ncccc21 |
| InChI | InChI=1S/C9H10N2O.C2H6/c1-6-7-3-2-4-10-8(7)5-11-9(6)12;1-2/h2-4,6H,5H2,1H3,(H,11,12);1-2H3 |
| InChIKey | LWXTZNQMCCVMKS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |