About ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one
ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one (PubChem CID 142177834) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one.
Molecular Properties
| Compound Name | ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one |
| PubChem CID | 142177834 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one |
| SMILES | CC.CC1C(=O)NCc2ncccc21 |
| InChI | InChI=1S/C9H10N2O.C2H6/c1-6-7-3-2-4-10-8(7)5-11-9(6)12;1-2/h2-4,6H,5H2,1H3,(H,11,12);1-2H3 |
| InChIKey | LWXTZNQMCCVMKS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one?
The IUPAC name of ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one (CID 142177834) is ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one.
What is the SMILES notation for ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one?
The canonical SMILES for ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one is CC.CC1C(=O)NCc2ncccc21.
What is the InChIKey of ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one?
The InChIKey is LWXTZNQMCCVMKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O.C2H6/c1-6-7-3-2-4-10-8(7)5-11-9(6)12;1-2/h2-4,6H,5H2,1H3,(H,11,12);1-2H3.
What are the key properties of ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one?
ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one has a molecular weight of 192.26 g/mol, XLogP of 1.84, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-7,8-dihydro-5H-1,7-naphthyridin-6-one is sourced from PubChem (CID 142177834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).