C10H14N2 — CID 83970782
5,7-dimethyl-5,6,7,8-tetrahydro-1,6-naphthyridine (PubChem CID 83970782) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 5,7-dimethyl-5,6,7,8-tetrahydro-1,6-naphthyridine.
| Compound Name | 5,7-dimethyl-5,6,7,8-tetrahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 83970782 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 5,7-dimethyl-5,6,7,8-tetrahydro-1,6-naphthyridine |
| SMILES | CC1Cc2ncccc2C(C)N1 |
| InChI | InChI=1S/C10H14N2/c1-7-6-10-9(8(2)12-7)4-3-5-11-10/h3-5,7-8,12H,6H2,1-2H3 |
| InChIKey | MKNJBGXADDWPHP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |