C12H15N — CID 154715452
(5aR,7R,8aR)-7-methyl-5,5a,6,7,8,8a-hexahydropentaleno[2,1-b]pyridine (PubChem CID 154715452) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (5aR,7R,8aR)-7-methyl-5,5a,6,7,8,8a-hexahydropentaleno[2,1-b]pyridine.
| Compound Name | (5aR,7R,8aR)-7-methyl-5,5a,6,7,8,8a-hexahydropentaleno[2,1-b]pyridine |
|---|---|
| PubChem CID | 154715452 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (5aR,7R,8aR)-7-methyl-5,5a,6,7,8,8a-hexahydropentaleno[2,1-b]pyridine |
| SMILES | C[C@@H]1C[C@@H]2Cc3ncccc3[C@@H]2C1 |
| InChI | InChI=1S/C12H15N/c1-8-5-9-7-12-10(11(9)6-8)3-2-4-13-12/h2-4,8-9,11H,5-7H2,1H3/t8-,9-,11-/m1/s1 |
| InChIKey | HGMMYYKVXLHVCR-FXPVBKGRSA-N |
| XLogP | 2.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |